ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
50907-20-5 5-(3-Fluorophenyl)-1H-tetrazole |
|
| Nome del prodotto | 5-(3-Fluorophenyl)-1H-tetrazole |
| Nome inglese | 5-(3-Fluorophenyl)-1H-tetrazole;5-(3-fluorophenyl)-2H-tetrazole |
| Formula molecolare | C7H5FN4 |
| Peso Molecolare | 164.1398 |
| InChI | InChI=1/C7H5FN4/c8-6-3-1-2-5(4-6)7-9-11-12-10-7/h1-4H,(H,9,10,11,12) |
| Numero CAS | 50907-20-5 |
| Struttura molecolare | ![]() |
| Densità | 1.403g/cm3 |
| Punto di ebollizione | 335.5°C at 760 mmHg |
| Indice di rifrazione | 1.591 |
| Punto d'infiammabilità | 156.7°C |
| Pressione di vapore | 0.00012mmHg at 25°C |
| Codici di Rischio | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Sicurezza Descrizione | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |