ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
51828-97-8 4-methylthio-2-oxobutyric acid, sodium salt |
|
| Nome del prodotto | 4-methylthio-2-oxobutyric acid, sodium salt |
| Nome inglese | 4-methylthio-2-oxobutyric acid, sodium salt;A-keto-gamma-methiolbutyric acid sodium;alpha-Keto-gamma-(methylthio)butyric acid sodium salt;4-Methylthio-2-oxobutanoic acid;butanoic acid, 4-(methylthio)-2-oxo-, sodium salt |
| Formula molecolare | C5H8NaO3S |
| Peso Molecolare | 171.17 |
| InChI | InChI=1/C5H8O3S.Na/c1-9-3-2-4(6)5(7)8;/h2-3H2,1H3,(H,7,8); |
| Numero CAS | 51828-97-8 |
| Struttura molecolare | ![]() |
| MSDS | |