ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
51994-16-2 4-hydroxy-2-(1-hydroxybutyl)-2,5-dimethylfuran-3(2H)-one |
|
| Nome del prodotto | 4-hydroxy-2-(1-hydroxybutyl)-2,5-dimethylfuran-3(2H)-one |
| Nome inglese | 4-hydroxy-2-(1-hydroxybutyl)-2,5-dimethylfuran-3(2H)-one;4-Hydroxy-2-(1-hydroxybutyl)-2,5-dimethylfuran-3(2H)-one |
| Formula molecolare | C10H16O4 |
| Peso Molecolare | 200.2316 |
| InChI | InChI=1/C10H16O4/c1-4-5-7(11)10(3)9(13)8(12)6(2)14-10/h7,11-12H,4-5H2,1-3H3 |
| Numero CAS | 51994-16-2 |
| EINECS | 257-591-5 |
| Struttura molecolare | ![]() |
| Densità | 1.198g/cm3 |
| Punto di ebollizione | 320.6°C at 760 mmHg |
| Indice di rifrazione | 1.519 |
| Punto d'infiammabilità | 122.5°C |
| Pressione di vapore | 2.54E-05mmHg at 25°C |
| MSDS | |