ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
52709-83-8 4-n-Butyl-4'-cyanobiphenyl |
|
| Nome del prodotto | 4-n-Butyl-4'-cyanobiphenyl |
| Nome inglese | 4-n-Butyl-4'-cyanobiphenyl;4-n-butyl-4-cyanobiphenyl;4-n-Butyl-4?cyanobiphenyl;4'-butylbiphenyl-4-carbonitrile;4'-Butyl-4-biphenylcarbonitrile;4-Cyano-4'-butylbiphenyl |
| Formula molecolare | C17H17N |
| Peso Molecolare | 235.3236 |
| InChI | InChI=1/C17H17N/c1-2-3-4-14-5-9-16(10-6-14)17-11-7-15(13-18)8-12-17/h5-12H,2-4H2,1H3 |
| Numero CAS | 52709-83-8 |
| EINECS | 258-119-0 |
| Struttura molecolare | ![]() |
| Densità | 1.04g/cm3 |
| Punto di ebollizione | 380.9°C at 760 mmHg |
| Indice di rifrazione | 1.576 |
| Punto d'infiammabilità | 185.3°C |
| Pressione di vapore | 5.26E-06mmHg at 25°C |
| MSDS | |