ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
53619-61-7 4-[(4-methylphenyl)sulfanyl]-7-nitro-2,1,3-benzoxadiazole |
|
| Nome del prodotto | 4-[(4-methylphenyl)sulfanyl]-7-nitro-2,1,3-benzoxadiazole |
| Nome inglese | 4-[(4-methylphenyl)sulfanyl]-7-nitro-2,1,3-benzoxadiazole;4-[(4-methylphenyl)thio]-7-nitro-2,1,3-benzoxadiazole |
| Formula molecolare | C13H9N3O3S |
| Peso Molecolare | 287.2939 |
| InChI | InChI=1/C13H9N3O3S/c1-8-2-4-9(5-3-8)20-11-7-6-10(16(17)18)12-13(11)15-19-14-12/h2-7H,1H3 |
| Numero CAS | 53619-61-7 |
| Struttura molecolare | ![]() |
| Densità | 1.48g/cm3 |
| Punto di ebollizione | 488.1°C at 760 mmHg |
| Indice di rifrazione | 1.71 |
| Punto d'infiammabilità | 249°C |
| Pressione di vapore | 3.35E-09mmHg at 25°C |
| MSDS | |