ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
53627-36-4 4-ethenyldihydrofuran-2(3H)-one |
|
| Nome del prodotto | 4-ethenyldihydrofuran-2(3H)-one |
| Nome inglese | 4-ethenyldihydrofuran-2(3H)-one;2(3H)-furanone, 4-ethenyldihydro-;4-Vinyldihydrofuran-2(3H)-on;4-vinyldihydrofuran-2(3H)-one |
| Formula molecolare | C6H8O2 |
| Peso Molecolare | 112.1265 |
| InChI | InChI=1/C6H8O2/c1-2-5-3-6(7)8-4-5/h2,5H,1,3-4H2 |
| Numero CAS | 53627-36-4 |
| Struttura molecolare | ![]() |
| Densità | 1.154g/cm3 |
| Punto di ebollizione | 209°C at 760 mmHg |
| Indice di rifrazione | 1.55 |
| Punto d'infiammabilità | 76.3°C |
| Pressione di vapore | 0.207mmHg at 25°C |
| MSDS | |