ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
54569-86-7 3'-(pyridin-4-yl)-3,4-dihydro-1H-spiro[naphthalene-2,2'-oxiran]-1-one |
|
| Nome del prodotto | 3'-(pyridin-4-yl)-3,4-dihydro-1H-spiro[naphthalene-2,2'-oxiran]-1-one |
| Nome inglese | 3'-(pyridin-4-yl)-3,4-dihydro-1H-spiro[naphthalene-2,2'-oxiran]-1-one; |
| Formula molecolare | C16H13NO2 |
| Peso Molecolare | 251.2799 |
| InChI | InChI=1/C16H13NO2/c18-14-13-4-2-1-3-11(13)5-8-16(14)15(19-16)12-6-9-17-10-7-12/h1-4,6-7,9-10,15H,5,8H2 |
| Numero CAS | 54569-86-7 |
| Struttura molecolare | ![]() |
| Densità | 1.31g/cm3 |
| Punto di ebollizione | 447.3°C at 760 mmHg |
| Indice di rifrazione | 1.654 |
| Punto d'infiammabilità | 224.3°C |
| Pressione di vapore | 3.41E-08mmHg at 25°C |
| MSDS | |