ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
55722-59-3 3,7-dimethyl-3,6-octadienal |
|
| Nome del prodotto | 3,7-dimethyl-3,6-octadienal |
| Nome inglese | 3,7-dimethyl-3,6-octadienal;3,6-Octadienal, 3,7-dimethyl-;Isocitral;3,7-Dimethyl-3,6-octadienal |
| Formula molecolare | C10H16O |
| Peso Molecolare | 152.235 |
| InChI | InChI=1/C10H16O/c1-9(2)5-4-6-10(3)7-8-11/h5-6,8H,4,7H2,1-3H3/b10-6+ |
| Numero CAS | 55722-59-3 |
| EINECS | 259-777-1 |
| Struttura molecolare | ![]() |
| MSDS | |