ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
| 55795-89-6 5-Methyltryptamine hydrochloride | |
| Nome del prodotto | 5-Methyltryptamine hydrochloride | 
| Nome inglese | 5-Methyltryptamine hydrochloride;3-(2-Aminoethyl)-5-methylindole hydrochloride;3-(2-methylaminoethyl)-5-methylindole hydrochloride;2-(5-Methyl-1H-indol-3-yl)ethylamine | 
| Formula molecolare | C11H15ClN2 | 
| Peso Molecolare | 210.7032 | 
| InChI | InChI=1/C11H14N2.ClH/c1-8-2-3-11-9(6-8)7-10(13-11)4-5-12;/h2-3,6-7,13H,4-5,12H2,1H3;1H | 
| Numero CAS | 55795-89-6 | 
| Struttura molecolare |  | 
| Punto di fusione | 288-292℃ | 
| Sicurezza Descrizione | S24/25##Avoid contact with skin and eyes.:; | 
| MSDS | |