ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
56375-85-0 4-bromo-3,5-dihydroxy-N-methylbenzamide |
|
| Nome del prodotto | 4-bromo-3,5-dihydroxy-N-methylbenzamide |
| Nome inglese | 4-bromo-3,5-dihydroxy-N-methylbenzamide;4-Bromo-3,5-dihydroxy-N-methylbenzamide |
| Formula molecolare | C8H8BrNO3 |
| Peso Molecolare | 246.058 |
| InChI | InChI=1/C8H8BrNO3/c1-10-8(13)4-2-5(11)7(9)6(12)3-4/h2-3,11-12H,1H3,(H,10,13) |
| Numero CAS | 56375-85-0 |
| EINECS | 260-137-9 |
| Struttura molecolare | ![]() |
| Densità | 1.722g/cm3 |
| Punto di ebollizione | 311.8°C at 760 mmHg |
| Indice di rifrazione | 1.637 |
| Punto d'infiammabilità | 142.3°C |
| Pressione di vapore | 0.000301mmHg at 25°C |
| MSDS | |