ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
56520-98-0 4-ethyl-2-nitrophenol |
|
| Nome del prodotto | 4-ethyl-2-nitrophenol |
| Nome inglese | 4-ethyl-2-nitrophenol;Phenol, 4-ethyl-2-nitro- |
| Formula molecolare | C8H9NO3 |
| Peso Molecolare | 167.162 |
| InChI | InChI=1/C8H9NO3/c1-2-6-3-4-8(10)7(5-6)9(11)12/h3-5,10H,2H2,1H3 |
| Numero CAS | 56520-98-0 |
| EINECS | 260-239-3 |
| Struttura molecolare | ![]() |
| Densità | 1.261g/cm3 |
| Punto di ebollizione | 267°C at 760 mmHg |
| Indice di rifrazione | 1.582 |
| Punto d'infiammabilità | 116.8°C |
| Pressione di vapore | 0.00509mmHg at 25°C |
| MSDS | |