ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
57435-89-9 5-(2-chlorophenyl)-6-methyl-3,7-dihydropyrrolo[3,4-e][1,4]diazepin-2(1H)-one |
|
| Nome del prodotto | 5-(2-chlorophenyl)-6-methyl-3,7-dihydropyrrolo[3,4-e][1,4]diazepin-2(1H)-one |
| Nome inglese | 5-(2-chlorophenyl)-6-methyl-3,7-dihydropyrrolo[3,4-e][1,4]diazepin-2(1H)-one; |
| Formula molecolare | C14H12ClN3O |
| Peso Molecolare | 273.7176 |
| InChI | InChI=1/C14H12ClN3O/c1-8-13-11(6-16-8)18-12(19)7-17-14(13)9-4-2-3-5-10(9)15/h2-6,16H,7H2,1H3,(H,18,19) |
| Numero CAS | 57435-89-9 |
| Struttura molecolare | ![]() |
| Densità | 1.42g/cm3 |
| Punto di ebollizione | 500.3°C at 760 mmHg |
| Indice di rifrazione | 1.694 |
| Punto d'infiammabilità | 256.4°C |
| Pressione di vapore | 3.84E-10mmHg at 25°C |
| MSDS | |