ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
57754-88-8 4-methyl-N-phenylpiperidine-1-carboxamide |
|
| Nome del prodotto | 4-methyl-N-phenylpiperidine-1-carboxamide |
| Nome inglese | 4-methyl-N-phenylpiperidine-1-carboxamide;1-piperidinecarboxamide, 4-methyl-N-phenyl-;4-Methyl-N-phenylpiperidine-1-carboxamide |
| Formula molecolare | C13H18N2O |
| Peso Molecolare | 218.2948 |
| InChI | InChI=1/C13H18N2O/c1-11-7-9-15(10-8-11)13(16)14-12-5-3-2-4-6-12/h2-6,11H,7-10H2,1H3,(H,14,16) |
| Numero CAS | 57754-88-8 |
| Struttura molecolare | ![]() |
| Densità | 1.113g/cm3 |
| Punto di ebollizione | 400°C at 760 mmHg |
| Indice di rifrazione | 1.578 |
| Punto d'infiammabilità | 195.7°C |
| Pressione di vapore | 1.32E-06mmHg at 25°C |
| MSDS | |