ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
59849-29-5 4-metossi-N-(fenilcarbamotioil)benzammide |
|
| Nome del prodotto | 4-metossi-N-(fenilcarbamotioil)benzammide |
| Nome inglese | 4-methoxy-N-(phenylcarbamothioyl)benzamide; |
| Formula molecolare | C15H14N2O2S |
| Peso Molecolare | 286.3489 |
| InChI | InChI=1/C15H14N2O2S/c1-19-13-9-7-11(8-10-13)14(18)17-15(20)16-12-5-3-2-4-6-12/h2-10H,1H3,(H2,16,17,18,20) |
| Numero CAS | 59849-29-5 |
| Struttura molecolare | ![]() |
| Densità | 1.286g/cm3 |
| Indice di rifrazione | 1.668 |
| MSDS | |