ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
602-55-1 9-Phenylanthracene |
|
| Nome del prodotto | 9-Phenylanthracene |
| Nome inglese | 9-Phenylanthracene;Phenylanthracene;anthracene,9-phenyl-;9-phenylantracene |
| Formula molecolare | C20H14 |
| Peso Molecolare | 254.3252 |
| InChI | InChI=1/C20H14/c1-2-8-15(9-3-1)20-18-12-6-4-10-16(18)14-17-11-5-7-13-19(17)20/h1-14H |
| Numero CAS | 602-55-1 |
| EINECS | 210-019-8 |
| Struttura molecolare | ![]() |
| Densità | 1.14g/cm3 |
| Punto di fusione | 149-153℃ |
| Punto di ebollizione | 417°C at 760 mmHg |
| Indice di rifrazione | 1.703 |
| Punto d'infiammabilità | 192.1°C |
| Pressione di vapore | 8.86E-07mmHg at 25°C |
| Sicurezza Descrizione | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |