ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
616-38-6 Dimethyl carbonate |
|
| Nome del prodotto | Dimethyl carbonate |
| Nome inglese | Dimethyl carbonate;Methyl carbonate;Carbonic acid dimethyl ester;DMC |
| Formula molecolare | C3H6O3 |
| Peso Molecolare | 90.0779 |
| InChI | InChI=1/C3H6O3/c1-5-3(4)6-2/h1-2H3 |
| Numero CAS | 616-38-6 |
| EINECS | 210-478-4 |
| Struttura molecolare | ![]() |
| Densità | 1.024g/cm3 |
| Punto di fusione | 2-4℃ |
| Punto di ebollizione | 90.5°C at 760 mmHg |
| Indice di rifrazione | 1.361 |
| Punto d'infiammabilità | 18.3°C |
| Solubilità in acqua | 139 g/L |
| Pressione di vapore | 56mmHg at 25°C |
| Simboli di pericolo | |
| Codici di Rischio | R11:; |
| Sicurezza Descrizione | S16||S9:; |
| MSDS | |