ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
72156-72-0 fenacetina-etossi-1-13C |
|
| Nome del prodotto | fenacetina-etossi-1-13C |
| Sinonimi | N-(4-etossifenil)acetammide; |
| Nome inglese | phenacetin-ethoxy-1-13C;N-(4-ethoxyphenyl)acetamide |
| Formula molecolare | C913CH13NO2 |
| Peso Molecolare | 180.2084 |
| InChI | InChI=1/C10H13NO2/c1-3-13-10-6-4-9(5-7-10)11-8(2)12/h4-7H,3H2,1-2H3,(H,11,12)/i3+1 |
| Numero CAS | 72156-72-0 |
| Struttura molecolare | ![]() |
| Densità | 1.099g/cm3 |
| Punto di fusione | 134-136℃ |
| Indice di rifrazione | 1.548 |
| MSDS | |