ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
73425-87-3 1-(6-fluoro-2,3,4,9-tetraidrotiopirano[2,3-b]indol-4-il)-N-metilmetanammina etandioato |
|
| Nome del prodotto | 1-(6-fluoro-2,3,4,9-tetraidrotiopirano[2,3-b]indol-4-il)-N-metilmetanammina etandioato |
| Sinonimi | ; |
| Nome inglese | 1-(6-fluoro-2,3,4,9-tetrahydrothiopyrano[2,3-b]indol-4-yl)-N-methylmethanamine ethanedioate; |
| Formula molecolare | C15H17FN2O4S |
| Peso Molecolare | 340.3699 |
| InChI | InChI=1/C13H15FN2S.C2H2O4/c1-15-7-8-4-5-17-13-12(8)10-6-9(14)2-3-11(10)16-13;3-1(4)2(5)6/h2-3,6,8,15-16H,4-5,7H2,1H3;(H,3,4)(H,5,6) |
| Numero CAS | 73425-87-3 |
| Struttura molecolare | ![]() |
| Punto di ebollizione | 404.8°C at 760 mmHg |
| Punto d'infiammabilità | 198.6°C |
| Pressione di vapore | 9.2E-07mmHg at 25°C |
| MSDS | |