ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
7470-10-2 3-(3,4-dihydroisoquinolin-2(1H)-yl)-1-(phenanthren-3-yl)propan-1-ol |
|
| Nome del prodotto | 3-(3,4-dihydroisoquinolin-2(1H)-yl)-1-(phenanthren-3-yl)propan-1-ol |
| Nome inglese | 3-(3,4-dihydroisoquinolin-2(1H)-yl)-1-(phenanthren-3-yl)propan-1-ol; |
| Formula molecolare | C26H25NO |
| Peso Molecolare | 367.4828 |
| InChI | InChI=1/C26H25NO/c28-26(14-16-27-15-13-19-5-1-2-7-23(19)18-27)22-12-11-21-10-9-20-6-3-4-8-24(20)25(21)17-22/h1-12,17,26,28H,13-16,18H2 |
| Numero CAS | 7470-10-2 |
| Struttura molecolare | ![]() |
| Densità | 1.19g/cm3 |
| Punto di ebollizione | 602.1°C at 760 mmHg |
| Indice di rifrazione | 1.687 |
| Punto d'infiammabilità | 334°C |
| Pressione di vapore | 2.38E-15mmHg at 25°C |
| MSDS | |