ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
814-78-8 Methyl isopropenyl ketone |
|
| Nome del prodotto | Methyl isopropenyl ketone |
| Nome inglese | Methyl isopropenyl ketone;2-Methyl-1-buten-3-one;2-Methyl-1-butene-3-one;3-Buten-2-one, 3-methyl-;3-Butene-2-one, 3-methyl;3-Methyl-3-buten-2-on;3-Methyl-3-buten-2-on [German];3-Methyl-3-buten-2-one;3-Methyl-3-butene-2-one;3-Methylene-2-butanone;4-01-00-03462 (Beilstein Handbook Reference);BRN 1071241;CCRIS 5317;HSDB 1164;Isopropenyl methyl ketone;Ketone, methyl isopropenyl;Methyl butenone;NSC 24150;Propen-2-yl methyl ketone;3-Methylbut-3-en-2-one;Methyl isopropenyl ketone, inhibited;Methyl isopropenyl ketone, inhibited [UN1246] [Flammable liquid];UN1246;5-methylhex-4-en-2-one |
| Formula molecolare | C7H12O |
| Peso Molecolare | 112.1696 |
| InChI | InChI=1/C7H12O/c1-6(2)4-5-7(3)8/h4H,5H2,1-3H3 |
| Numero CAS | 814-78-8 |
| EINECS | 212-405-1 |
| Struttura molecolare | ![]() |
| Densità | 0.833g/cm3 |
| Punto di ebollizione | 147.975°C at 760 mmHg |
| Indice di rifrazione | 1.425 |
| Punto d'infiammabilità | 39.006°C |
| Pressione di vapore | 4.314mmHg at 25°C |
| MSDS | |