ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
814-91-5 Copper(II)oxalate hemihydrate |
|
| Nome del prodotto | Copper(II)oxalate hemihydrate |
| Nome inglese | Copper(II)oxalate hemihydrate;copper-ethanedioic acid hydrate (1:1:1);Copper (II) oxalate hemihydrate;Copperoxalatehemihydratebluepowder;copper(2+) ethanedioate;1-[4-(methylsulfanyl)phenyl]-3-[4-(piperidin-1-yl)-3-(pyrrolidin-1-ylcarbonyl)phenyl]urea;Copper (II) oxalate;Copper(II) oxalate;Cupricoxalate;Cupric oxalate |
| Formula molecolare | C24H30N4O2S |
| Peso Molecolare | 438.5856 |
| InChI | InChI=1/C24H30N4O2S/c1-31-20-10-7-18(8-11-20)25-24(30)26-19-9-12-22(27-13-3-2-4-14-27)21(17-19)23(29)28-15-5-6-16-28/h7-12,17H,2-6,13-16H2,1H3,(H2,25,26,30) |
| Numero CAS | 814-91-5;5893-66-3 |
| EINECS | 212-411-4 |
| Struttura molecolare | ![]() |
| Densità | 1.28g/cm3 |
| Punto di ebollizione | 582.7°C at 760 mmHg |
| Indice di rifrazione | 1.659 |
| Punto d'infiammabilità | 306.2°C |
| Pressione di vapore | 1.44E-13mmHg at 25°C |
| MSDS | |