ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
814-93-7 lead oxalate |
|
| Nome del prodotto | lead oxalate |
| Nome inglese | lead oxalate;Lead oxalate;Lead(II) oxalate;Ethanedioic acid, lead(2+) salt (1:1);lead(2+) ethanedioate |
| Formula molecolare | C2O4Pb |
| Peso Molecolare | 295.219 |
| InChI | InChI=1/C2H2O4.Pb/c3-1(4)2(5)6;/h(H,3,4)(H,5,6);/q;+2/p-2 |
| Numero CAS | 814-93-7 |
| EINECS | 212-413-5 |
| Struttura molecolare | ![]() |
| Punto di ebollizione | 365.1°C at 760 mmHg |
| Punto d'infiammabilità | 188.8°C |
| Pressione di vapore | 2.51E-06mmHg at 25°C |
| MSDS | |