ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
816-68-2 lead malate |
|
| Nome del prodotto | lead malate |
| Nome inglese | lead malate;Lead malate;Colloidal lead malate;Lead malate, colloidal;Butanedioic acid, hydroxy-, lead(2+) salt (1:1);lead(2+) 2-hydroxybutanedioate |
| Formula molecolare | C4H4O5Pb |
| Peso Molecolare | 339.2716 |
| InChI | InChI=1/C4H6O5.Pb/c5-2(4(8)9)1-3(6)7;/h2,5H,1H2,(H,6,7)(H,8,9);/q;+2/p-2 |
| Numero CAS | 816-68-2 |
| EINECS | 212-436-0 |
| Struttura molecolare | ![]() |
| Punto di ebollizione | 306.4°C at 760 mmHg |
| Punto d'infiammabilità | 153.4°C |
| Pressione di vapore | 7.19E-05mmHg at 25°C |
| MSDS | |