ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
84-97-9 10-(3-(4-methyl-1-piperazinyl)propyl)-10H-phenothiazine |
|
| Nome del prodotto | 10-(3-(4-methyl-1-piperazinyl)propyl)-10H-phenothiazine |
| Nome inglese | 10-(3-(4-methyl-1-piperazinyl)propyl)-10H-phenothiazine;perazine;10-[3-(4-methylpiperazin-1-yl)propyl]-10H-phenothiazine |
| Formula molecolare | C20H25N3S |
| Peso Molecolare | 339.4976 |
| InChI | InChI=1/C20H25N3S/c1-21-13-15-22(16-14-21)11-6-12-23-17-7-2-4-9-19(17)24-20-10-5-3-8-18(20)23/h2-5,7-10H,6,11-16H2,1H3 |
| Numero CAS | 84-97-9 |
| EINECS | 201-578-9 |
| Struttura molecolare | ![]() |
| Densità | 1.149g/cm3 |
| Punto di ebollizione | 493.6°C at 760 mmHg |
| Indice di rifrazione | 1.615 |
| Punto d'infiammabilità | 252.3°C |
| Pressione di vapore | 6.91E-10mmHg at 25°C |
| MSDS | |