ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
87-29-6 cinnamyl anthranilate |
|
| Nome del prodotto | cinnamyl anthranilate |
| Nome inglese | cinnamyl anthranilate;2-Aminobenzoic acid cinnamyl ester~Cinnamyl anthranilate;3-phenylprop-2-en-1-yl 2-aminobenzoate;(2E)-3-phenylprop-2-en-1-yl 2-aminobenzoate |
| Formula molecolare | C16H15NO2 |
| Peso Molecolare | 253.2958 |
| InChI | InChI=1/C16H15NO2/c17-15-11-5-4-10-14(15)16(18)19-12-6-9-13-7-2-1-3-8-13/h1-11H,12,17H2/b9-6+ |
| Numero CAS | 87-29-6 |
| EINECS | 201-738-8 |
| Struttura molecolare | ![]() |
| Densità | 1.178g/cm3 |
| Punto di ebollizione | 449.1°C at 760 mmHg |
| Indice di rifrazione | 1.642 |
| Punto d'infiammabilità | 269.4°C |
| Pressione di vapore | 2.95E-08mmHg at 25°C |
| Sicurezza Descrizione | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |