ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
87-40-1 2,4,6-trichloroanisole |
|
| Nome del prodotto | 2,4,6-trichloroanisole |
| Nome inglese | 2,4,6-trichloroanisole; |
| Formula molecolare | C7H5Cl3O |
| Peso Molecolare | 211.473 |
| InChI | InChI=1/C7H5Cl3O/c1-11-7-5(9)2-4(8)3-6(7)10/h2-3H,1H3 |
| Numero CAS | 87-40-1 |
| EINECS | 201-743-5 |
| Struttura molecolare | ![]() |
| Densità | 1.416g/cm3 |
| Punto di fusione | 60-62℃ |
| Punto di ebollizione | 246°C at 760 mmHg |
| Indice di rifrazione | 1.55 |
| Punto d'infiammabilità | 100.4°C |
| Pressione di vapore | 0.0436mmHg at 25°C |
| MSDS | |