ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
88-86-8 2,5-dichloro-3-nitrobenzoic acid |
|
| Nome del prodotto | 2,5-dichloro-3-nitrobenzoic acid |
| Nome inglese | 2,5-dichloro-3-nitrobenzoic acid;Benzoic acid, 2,5-dichloro-3-nitro-;2,5-Dichloro-3-nitrobenzoic acid;2,5-Dichloro-4-nitrobenzoic acid;2-09-00-00276 (Beilstein Handbook Reference);3-Nitro-2,5-dichlorobenzoic acid;BRN 1976119;Caswell No. 312;Dinoben;EPA Pesticide Chemical Code 028101;Kyselina 2,5-dichlor-3-nitrobenzoova;Kyselina 2,5-dichlor-3-nitrobenzoova [Czech] |
| Formula molecolare | C7H3Cl2NO4 |
| Peso Molecolare | 236.009 |
| InChI | InChI=1/C7H3Cl2NO4/c8-3-1-4(7(11)12)6(9)5(2-3)10(13)14/h1-2H,(H,11,12) |
| Numero CAS | 88-86-8 |
| EINECS | 201-862-2 |
| Struttura molecolare | ![]() |
| Densità | 1.713g/cm3 |
| Punto di fusione | 216-220℃ |
| Punto di ebollizione | 366.5°C at 760 mmHg |
| Indice di rifrazione | 1.638 |
| Punto d'infiammabilità | 175.5°C |
| Pressione di vapore | 5.11E-06mmHg at 25°C |
| Codici di Rischio | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Sicurezza Descrizione | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |