ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
89-68-9 6-chlorothymol |
|
| Nome del prodotto | 6-chlorothymol |
| Nome inglese | 6-chlorothymol;Chlorothymol [NF XII];4-Chloro-5-methyl-2-(1-methylethyl)phenol;6-Chlorothymol;Chlorothymol;Phenol, 4-chloro-5-methyl-2-(1-methylethyl)-;4-06-00-03344 (Beilstein Handbook Reference);4-Chlor-2-isopropyl-5-methylphenol;4-Chloro-6-isopropyl-3-methylphenol;4-Chlorothymol;AI3-00120;BRN 2084453;Caswell No. 216;Chlorthymol;EPA Pesticide Chemical Code 080403;NSC 406261;UNII-LJ25TI0CVT;Thymol, 6-chloro-;4-chloro-5-methyl-2-(propan-2-yl)phenol |
| Formula molecolare | C10H13ClO |
| Peso Molecolare | 184.6626 |
| InChI | InChI=1/C10H13ClO/c1-6(2)8-5-9(11)7(3)4-10(8)12/h4-6,12H,1-3H3 |
| Numero CAS | 89-68-9 |
| EINECS | 201-930-1 |
| Struttura molecolare | ![]() |
| Densità | 1.111g/cm3 |
| Punto di fusione | 60-62℃ |
| Punto di ebollizione | 257.4°C at 760 mmHg |
| Indice di rifrazione | 1.538 |
| Punto d'infiammabilità | 109.5°C |
| Pressione di vapore | 0.00906mmHg at 25°C |
| Simboli di pericolo | |
| Sicurezza Descrizione | S26||S36:; |
| MSDS | |