ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
102052-39-1 2,3-Dichlorophenylacetone |
|
상품명칭 | 2,3-Dichlorophenylacetone |
영문 이름 | 2,3-Dichlorophenylacetone;1-(2,3-dichlorophenyl)propan-2-one |
분자식 | C9H8Cl2O |
분자량 | 203.0652 |
InChI | InChI=1/C9H8Cl2O/c1-6(12)5-7-3-2-4-8(10)9(7)11/h2-4H,5H2,1H3 |
cas번호 | 102052-39-1 |
분자 구조 | ![]() |
밀도 | 1.27g/cm3 |
비등점 | 271.3°C at 760 mmHg |
굴절 지수 | 1.541 |
인화점 | 112.5°C |
증기압 | 0.00649mmHg at 25°C |
보안 규칙 | S24/25##Avoid contact with skin and eyes.:; |
MSDS |