ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
106070-58-0 2,5-Diamino-3-picoline |
|
상품명칭 | 2,5-Diamino-3-picoline |
영문 이름 | 2,5-Diamino-3-picoline;3-methylpyridine-2,5-diamine;2,5-diamino-3-methylpyridinium |
분자식 | C6H10N3 |
분자량 | 124.1632 |
InChI | InChI=1/C6H9N3/c1-4-2-5(7)3-9-6(4)8/h2-3H,7H2,1H3,(H2,8,9)/p+1 |
cas번호 | 106070-58-0 |
분자 구조 | ![]() |
비등점 | 329.2°C at 760 mmHg |
인화점 | 179.2°C |
증기압 | 0.00018mmHg at 25°C |
위험성 표시 | |
리스크 규칙 | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |