ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
119584-70-2 2,4-Diamino-5-fluoroquinazoline |
|
상품명칭 | 2,4-Diamino-5-fluoroquinazoline |
영문 이름 | 2,4-Diamino-5-fluoroquinazoline;5-Fluoroquinazoline-2,4-diamine |
분자식 | C8H7FN4 |
분자량 | 178.1664 |
InChI | InChI=1/C8H7FN4/c9-4-2-1-3-5-6(4)7(10)13-8(11)12-5/h1-3H,(H4,10,11,12,13) |
cas번호 | 119584-70-2 |
분자 구조 | ![]() |
밀도 | 1.5g/cm3 |
비등점 | 463.1°C at 760 mmHg |
굴절 지수 | 1.757 |
인화점 | 233.9°C |
증기압 | 9.34E-09mmHg at 25°C |
리스크 규칙 | R22##Harmful if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |