Chemindex > 15219-34-8
KR ▼
15219-34-8 Oxalyl bromide |
|
| 상품명칭 | Oxalyl bromide |
| 영문 이름 | Oxalyl bromide;Ethanedioyl dibromide;Ethanedioyl bromide;NSC 96957;Oxalyl bromide |
| 분자식 | C2Br2O2 |
| 분자량 | 215.8282 |
| InChI | InChI=1/C2Br2O2/c3-1(5)2(4)6 |
| cas번호 | 15219-34-8 |
| EC번호 | 239-271-7 |
| 분자 구조 |  |
| 밀도 | 2.627g/cm3 |
| 녹는 점 | -19℃ |
| 비등점 | 118.3°C at 760 mmHg |
| 굴절 지수 | 1.567 |
| 인화점 | 109.8°C |
| 증기압 | 16.8mmHg at 25°C |
| 위험성 표시 |  C##Corrosive:; |
| 리스크 규칙 | R34##Causes burns.:; |
| 보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |
- 중국에서 화학 물질을 공급할 계획이라면 ChemNet 쇼핑몰로 이동하면 중국 제조업체로부터 최신의 경쟁력있는 가격을 얻을 수 있습니다.방문하십시오
ChemNet Mall
Chemical CAS Database Service는 ChemIndex.com 에서 제공합니다. 