ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
175135-61-2 3-클로로-6-[(5-클로로-3-피리딜)옥시]피리다진 |
|
상품명칭 | 3-클로로-6-[(5-클로로-3-피리딜)옥시]피리다진 |
별명 | 3-클로로-6-[(5-클로로피리딘-3-일)옥시]피리다진; |
영문 이름 | 3-chloro-6-[(5-chloro-3-pyridyl)oxy]pyridazine;3-chloro-6-[(5-chloropyridin-3-yl)oxy]pyridazine |
분자식 | C9H5Cl2N3O |
분자량 | 242.0615 |
InChI | InChI=1/C9H5Cl2N3O/c10-6-3-7(5-12-4-6)15-9-2-1-8(11)13-14-9/h1-5H |
cas번호 | 175135-61-2 |
분자 구조 | ![]() |
밀도 | 1.479g/cm3 |
녹는 점 | 107℃ |
비등점 | 410.5°C at 760 mmHg |
굴절 지수 | 1.61 |
인화점 | 202.1°C |
증기압 | 1.42E-06mmHg at 25°C |
위험성 표시 | |
리스크 규칙 | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |