Chemindex > 20469-71-0
KR ▼
20469-71-0 히드라진 -1- 카르 보디 티오산 히드라진 |
|
| 상품명칭 | 히드라진 -1- 카르 보디 티오산 히드라진 |
| 별명 | 히드라진카르보디티오산, compd.with 히드라진 (1:1); 카르바직산, 디티오-, 히드라지늄염; 디암모늄 디티오카르바제이트; 디티오카르바지산 compd.히드라진 (1 : 1); 디티오카르바지산(Dithiocarbazic acid) 히드라진 (소금); 디티오카본산(Dithiocarbonic acid) 모노하이드라지드 히드라진 염; 히드라지늄 디티오카르바제이트; NSC 512576; 카르바직산, 디티오-, compd.히드라진 (1 : 1) (8CI); 카르바직산, 디티오-, 히드라진(소금); 디티오카르바직산, 히드라진과 화합물 (1:1); 카르바직산, 디티오-, compd.히드라진 (1 : 1); 히드라진카르보디티오산 - 히드라진 (1:1); |
| 영문 이름 | hydrazine-1-carbodithioic acid hydrazine;Hydrazinecarbodithioic acid, compd. with hydrazine (1:1);Carbazic acid, dithio-, hydrazinium salt;Diammonium dithiocarbazate;Dithiocarbazic acid compd. with hydrazine (1:1);Dithiocarbazic acid hydrazine (salt);Dithiocarbonic acid monohydrazide hydrazine salt;Hydrazinium dithiocarbazate;NSC 512576;Carbazic acid, dithio-, compd. with hydrazine (1:1) (8CI);Carbazic acid, dithio-, hydrazine (salt);Dithiocarbazic acid, compound with hydrazine (1:1);Carbazic acid, dithio-, compd. with hydrazine (1:1);hydrazinecarbodithioic acid - hydrazine (1:1) |
| 분자식 | CH8N4S2 |
| 분자량 | 140.231 |
| InChI | InChI=1/CH4N2S2.H4N2/c2-3-1(4)5;1-2/h2H2,(H2,3,4,5);1-2H2 |
| cas번호 | 20469-71-0 |
| EC번호 | 243-844-7 |
| 분자 구조 |  |
| 비등점 | 174.1°C at 760 mmHg |
| 인화점 | 59.1°C |
| 증기압 | 1.22mmHg at 25°C |
| MSDS | |
- 중국에서 화학 물질을 공급할 계획이라면 ChemNet 쇼핑몰로 이동하면 중국 제조업체로부터 최신의 경쟁력있는 가격을 얻을 수 있습니다.방문하십시오
ChemNet Mall
20469-71-0 (0) 공급 업체:
Chemical CAS Database Service는 ChemIndex.com 에서 제공합니다. 