ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
33155-90-7 Hydroxybenzoquinoline |
|
상품명칭 | Hydroxybenzoquinoline |
영문 이름 | Hydroxybenzoquinoline;10-Hydroxybenzo[h]quinoline;benzo[h]quinolin-10-ol |
분자식 | C13H9NO |
분자량 | 195.2167 |
InChI | InChI=1/C13H9NO/c15-11-5-1-3-9-6-7-10-4-2-8-14-13(10)12(9)11/h1-8,15H |
cas번호 | 33155-90-7 |
분자 구조 | ![]() |
밀도 | 1.307g/cm3 |
비등점 | 420.621°C at 760 mmHg |
굴절 지수 | 1.768 |
인화점 | 208.184°C |
증기압 | 0mmHg at 25°C |
리스크 규칙 | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |