ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
4437-85-8 4-에틸-1,3-디옥솔란-2-온 |
|
상품명칭 | 4-에틸-1,3-디옥솔란-2-온 |
별명 | ; 부틸렌 카보네이트; (4S)-4-에틸-1,3-디옥솔란-2-온; (4R)-4-에틸-1,3-디옥솔란-2-온; 4-(카르복시옥시)부틸 카보네이트; |
영문 이름 | 4-Ethyl-1,3-dioxolan-2-one;Butylene carbonate;(4S)-4-ethyl-1,3-dioxolan-2-one;(4R)-4-ethyl-1,3-dioxolan-2-one;4-(carboxyoxy)butyl carbonate |
분자식 | C6H9O6 |
분자량 | 177.1326 |
InChI | InChI=1/C6H10O6/c7-5(8)11-3-1-2-4-12-6(9)10/h1-4H2,(H,7,8)(H,9,10)/p-1 |
cas번호 | 4437-85-8 |
분자 구조 | ![]() |
비등점 | 361.205°C at 760 mmHg |
인화점 | 152.029°C |
증기압 | 0mmHg at 25°C |
보안 규칙 | S24/25##Avoid contact with skin and eyes.:; |
MSDS |