ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
4819-69-6 N-(4-Chloro-2-butynyl)phthalimide |
|
상품명칭 | N-(4-Chloro-2-butynyl)phthalimide |
영문 이름 | N-(4-Chloro-2-butynyl)phthalimide;1-Chloro-4-(N-phthalimido)-2-butyne;2-(4-chlorobut-2-yn-1-yl)-1H-isoindole-1,3(2H)-dione |
분자식 | C12H8ClNO2 |
분자량 | 233.6504 |
InChI | InChI=1/C12H8ClNO2/c13-7-3-4-8-14-11(15)9-5-1-2-6-10(9)12(14)16/h1-2,5-6H,7-8H2 |
cas번호 | 4819-69-6 |
분자 구조 | ![]() |
밀도 | 1.391g/cm3 |
비등점 | 389.3°C at 760 mmHg |
굴절 지수 | 1.621 |
인화점 | 189.2°C |
증기압 | 2.88E-06mmHg at 25°C |
리스크 규칙 | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |