ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
494799-18-7 메틸 3- 시클로 헥실 -1H- 인돌 -6- 카르 복실 레이트 |
|
| 상품명칭 | 메틸 3- 시클로 헥실 -1H- 인돌 -6- 카르 복실 레이트 |
| 별명 | ; 1H-인돌-6-카르복실산, 3-시클로헥실-, 메틸 에스테르; 3-시클로헥실린돌-6-카르복실산 메틸 에스테르; 메틸 3-시클로헥실-1H-인돌-6-카르복실레이트 |
| 영문 이름 | methyl 3-cyclohexyl-1H-indole-6-carboxylate;1H-indole-6-carboxylic acid, 3-cyclohexyl-, methyl ester;3-Cyclohexylindole-6-carboxylic acid methyl ester ;Methyl 3-cyclohexyl-1H-indole-6-carboxylate |
| 분자식 | C16H19NO2 |
| 분자량 | 257.3276 |
| InChI | InChI=1/C16H19NO2/c1-19-16(18)12-7-8-13-14(10-17-15(13)9-12)11-5-3-2-4-6-11/h7-11,17H,2-6H2,1H3 |
| cas번호 | 494799-18-7 |
| 분자 구조 | ![]() |
| 밀도 | 1.164g/cm3 |
| 비등점 | 431.6°C at 760 mmHg |
| 굴절 지수 | 1.605 |
| 인화점 | 214.8°C |
| 증기압 | 1.18E-07mmHg at 25°C |
| MSDS | |