ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
496-11-7 Hydrindene |
|
| 상품명칭 | Hydrindene |
| 영문 이름 | Hydrindene;Indan;Indane;2,3-dihydro-1H-indene |
| 분자식 | C9H10 |
| 분자량 | 118.1757 |
| InChI | InChI=1/C9H10/c1-2-5-9-7-3-6-8(9)4-1/h1-2,4-5H,3,6-7H2 |
| cas번호 | 496-11-7 |
| EC번호 | 207-814-7 |
| 분자 구조 | ![]() |
| 밀도 | 0.997g/cm3 |
| 비등점 | 176.5°C at 760 mmHg |
| 굴절 지수 | 1.561 |
| 인화점 | 50°C |
| 증기압 | 1.47mmHg at 25°C |
| MSDS | |