ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
50342-17-1 4'-Bromo-2'-hydroxy-5'-methylacetophenone |
|
| 상품명칭 | 4'-Bromo-2'-hydroxy-5'-methylacetophenone |
| 영문 이름 | 4'-Bromo-2'-hydroxy-5'-methylacetophenone;1-(4-bromo-2-hydroxy-5-methyl-phenyl)ethanone |
| 분자식 | C9H9BrO2 |
| 분자량 | 229.0706 |
| InChI | InChI=1/C9H9BrO2/c1-5-3-7(6(2)11)9(12)4-8(5)10/h3-4,12H,1-2H3 |
| cas번호 | 50342-17-1 |
| 분자 구조 | ![]() |
| 밀도 | 1.508g/cm3 |
| 비등점 | 308.5°C at 760 mmHg |
| 굴절 지수 | 1.581 |
| 인화점 | 140.4°C |
| 증기압 | 0.000373mmHg at 25°C |
| MSDS | |