ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
50992-44-4 4-클로로-5-이소프로필-m-크레졸 |
|
| 상품명칭 | 4-클로로-5-이소프로필-m-크레졸 |
| 별명 | 4-클로로-5-이소프로필-m-크레졸; 4- 클로로 -3- 메틸 -5- (1- 메틸 에틸) 페놀; |
| 영문 이름 | 4-chloro-5-isopropyl-m-cresol;4-Chloro-5-isopropyl-m-cresol;4-chloro-3-methyl-5-(1-methylethyl)phenol |
| 분자식 | C10H13ClO |
| 분자량 | 184.6626 |
| InChI | InChI=1/C10H13ClO/c1-6(2)9-5-8(12)4-7(3)10(9)11/h4-6,12H,1-3H3 |
| cas번호 | 50992-44-4 |
| EC번호 | 256-899-7 |
| 분자 구조 | ![]() |
| 밀도 | 1.111g/cm3 |
| 비등점 | 271.8°C at 760 mmHg |
| 굴절 지수 | 1.538 |
| 인화점 | 118.2°C |
| 증기압 | 0.0038mmHg at 25°C |
| MSDS | |