Chemindex > 52315-06-7
KR ▼
52315-06-7 3-Phenoxybenzaldehyde cyanohydrin |
|
| 상품명칭 | 3-Phenoxybenzaldehyde cyanohydrin |
| 영문 이름 | 3-Phenoxybenzaldehyde cyanohydrin;alpha-Hydroxy-3-phenoxyphenylacetonitrile;hydroxy(3-phenoxyphenyl)acetonitrile |
| 분자식 | C14H11NO2 |
| 분자량 | 225.2426 |
| InChI | InChI=1/C14H11NO2/c15-10-14(16)11-5-4-8-13(9-11)17-12-6-2-1-3-7-12/h1-9,14,16H |
| cas번호 | 52315-06-7 |
| EC번호 | 257-841-3 |
| 분자 구조 |  |
| 밀도 | 1.22g/cm3 |
| 비등점 | 399.8°C at 760 mmHg |
| 굴절 지수 | 1.606 |
| 인화점 | 195.6°C |
| 증기압 | 4.13E-07mmHg at 25°C |
| 위험성 표시 |  F##Highly flammable||T##Toxic:; |
| 리스크 규칙 | R11##Highly flammable.||R23/24/25##Toxic by inhalation, in contact with skin and if swallowed.:; |
| 보안 규칙 | S16##Keep away from sources of ignition - No smoking.||S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |
- 중국에서 화학 물질을 공급할 계획이라면 ChemNet 쇼핑몰로 이동하면 중국 제조업체로부터 최신의 경쟁력있는 가격을 얻을 수 있습니다.방문하십시오
ChemNet Mall
Chemical CAS Database Service는 ChemIndex.com 에서 제공합니다. 