Chemindex > 5266-85-3
KR ▼
5266-85-3 2-Methyl-6-isopropylaniline |
|
| 상품명칭 | 2-Methyl-6-isopropylaniline |
| 영문 이름 | 2-Methyl-6-isopropylaniline;2-Methyl-6-(1-methylethyl)benzenamine;2-Isopropyl-6-methylaniline;6-isopropyl-o-toluidine;2-methyl-6-(propan-2-yl)aniline |
| 분자식 | C10H15N |
| 분자량 | 149.2328 |
| InChI | InChI=1/C10H15N/c1-7(2)9-6-4-5-8(3)10(9)11/h4-7H,11H2,1-3H3 |
| cas번호 | 5266-85-3 |
| EC번호 | 226-083-5 |
| 분자 구조 |  |
| 밀도 | 0.944g/cm3 |
| 비등점 | 236.2°C at 760 mmHg |
| 굴절 지수 | 1.538 |
| 인화점 | 97.8°C |
| 증기압 | 0.048mmHg at 25°C |
| 위험성 표시 |  Xn##Harmful:; |
| 리스크 규칙 | R10##Flammable.||R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
| 보안 규칙 | S16##Keep away from sources of ignition - No smoking.||S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |
- 중국에서 화학 물질을 공급할 계획이라면 ChemNet 쇼핑몰로 이동하면 중국 제조업체로부터 최신의 경쟁력있는 가격을 얻을 수 있습니다.방문하십시오
ChemNet Mall
Chemical CAS Database Service는 ChemIndex.com 에서 제공합니다. 