ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
54290-64-1 3,7- 비스 (디 에틸 아미노) 페녹 진 -5- 이엄 클로라이드, 염화 아연과 화합물 |
|
상품명칭 | 3,7- 비스 (디 에틸 아미노) 페녹 진 -5- 이엄 클로라이드, 염화 아연과 화합물 |
별명 | 3,7-비스(디에틸아미노)페녹사진-5-이움 클로라이드, 염화아연과 화합물; 에탄아미늄, N-[7-(디에틸아미노)-3H-페녹사진-3-일리덴]-N-에틸-, 삼염화물, 아연염; |
영문 이름 | 3,7-bis(diethylamino)phenoxazin-5-ium chloride, compound with zinc chloride;3,7-Bis(diethylamino)phenoxazin-5-ium chloride, compound with zincchloride;ethanaminium, N-[7-(diethylamino)-3H-phenoxazin-3-ylidene]-N-ethyl-, trichloride, zinc salt |
분자식 | C20H26Cl3N3OZn |
분자량 | 496.2079 |
InChI | InChI=1/C20H26N3O.3ClH.Zn/c1-5-22(6-2)15-9-11-17-19(13-15)24-20-14-16(23(7-3)8-4)10-12-18(20)21-17;;;;/h9-14H,5-8H2,1-4H3;3*1H;/q+1;;;;+2/p-3 |
cas번호 | 54290-64-1 |
EC번호 | 259-070-8 |
분자 구조 | ![]() |
MSDS |