ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
54395-92-5 4-oxo-4-(tricyclo[3.3.1.1~3,7~]dec-1-ylamino)but-2-enoic acid |
|
| 상품명칭 | 4-oxo-4-(tricyclo[3.3.1.1~3,7~]dec-1-ylamino)but-2-enoic acid |
| 영문 이름 | 4-oxo-4-(tricyclo[3.3.1.1~3,7~]dec-1-ylamino)but-2-enoic acid; |
| 분자식 | C14H19NO3 |
| 분자량 | 249.3056 |
| InChI | InChI=1/C14H19NO3/c16-12(1-2-13(17)18)15-14-6-9-3-10(7-14)5-11(4-9)8-14/h1-2,9-11H,3-8H2,(H,15,16)(H,17,18) |
| cas번호 | 54395-92-5 |
| 분자 구조 | ![]() |
| 밀도 | 1.25g/cm3 |
| 비등점 | 478.1°C at 760 mmHg |
| 굴절 지수 | 1.58 |
| 인화점 | 242.9°C |
| 증기압 | 1.87E-10mmHg at 25°C |
| MSDS | |