ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
57774-36-4 4'-Chloro-4-cyanobiphenyl |
|
| 상품명칭 | 4'-Chloro-4-cyanobiphenyl |
| 영문 이름 | 4'-Chloro-4-cyanobiphenyl;[1,1'-biphenyl]-4-carbonitrile, 4'-chloro-;4'-Chlorobiphenyl-4-carbonitrile |
| 분자식 | C13H8ClN |
| 분자량 | 213.6623 |
| InChI | InChI=1/C13H8ClN/c14-13-7-5-12(6-8-13)11-3-1-10(9-15)2-4-11/h1-8H |
| cas번호 | 57774-36-4 |
| 분자 구조 | ![]() |
| 밀도 | 1.24g/cm3 |
| 비등점 | 359.8°C at 760 mmHg |
| 굴절 지수 | 1.628 |
| 인화점 | 156.4°C |
| 증기압 | 2.32E-05mmHg at 25°C |
| MSDS | |