ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
58457-57-1 4-(2,4-디클로로페닐)-4-옥소부탄산 |
|
| 상품명칭 | 4-(2,4-디클로로페닐)-4-옥소부탄산 |
| 영문 이름 | 4-(2,4-dichlorophenyl)-4-oxobutanoic acid; |
| 분자식 | C10H8Cl2O3 |
| 분자량 | 247.0747 |
| InChI | InChI=1/C10H8Cl2O3/c11-6-1-2-7(8(12)5-6)9(13)3-4-10(14)15/h1-2,5H,3-4H2,(H,14,15) |
| cas번호 | 58457-57-1 |
| 분자 구조 | ![]() |
| 밀도 | 1.432g/cm3 |
| 비등점 | 408.739°C at 760 mmHg |
| 굴절 지수 | 1.574 |
| 인화점 | 200.999°C |
| 증기압 | 0mmHg at 25°C |
| MSDS | |