ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
58668-20-5 4-니트로-2,5-비스(2,4,6-트리니트로페닐)-1,3-티아졸 |
|
| 상품명칭 | 4-니트로-2,5-비스(2,4,6-트리니트로페닐)-1,3-티아졸 |
| 영문 이름 | 4-nitro-2,5-bis(2,4,6-trinitrophenyl)-1,3-thiazole; |
| 분자식 | C15H4N8O14S |
| 분자량 | 552.3025 |
| InChI | InChI=1/C15H4N8O14S/c24-17(25)5-1-7(19(28)29)11(8(2-5)20(30)31)13-14(23(36)37)16-15(38-13)12-9(21(32)33)3-6(18(26)27)4-10(12)22(34)35/h1-4H |
| cas번호 | 58668-20-5 |
| 분자 구조 | ![]() |
| 밀도 | 1.933g/cm3 |
| 비등점 | 724°C at 760 mmHg |
| 굴절 지수 | 1.761 |
| 인화점 | 391.7°C |
| 증기압 | 5.71E-20mmHg at 25°C |
| MSDS | |