ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
60062-20-6 인산, compd.with 2-(4-thiazolyl)-1H-benzimidazole (1:1) |
|
| 상품명칭 | 인산, compd.with 2-(4-thiazolyl)-1H-benzimidazole (1:1) |
| 별명 | ; 28558-32-9 {차아인산염}; |
| 영문 이름 | phosphenous acid, compd. with 2-(4-thiazolyl)-1H-benzimidazole (1:1);28558-32-9 {Hypophosphite} |
| 분자식 | C10H8N3O2PS |
| 분자량 | 265.2282 |
| InChI | InChI=1/C10H7N3S.HO2P/c1-2-4-8-7(3-1)12-10(13-8)9-5-14-6-11-9;1-3-2/h1-6H,(H,12,13);(H,1,2) |
| cas번호 | 60062-20-6;70088-28-7 |
| 분자 구조 | ![]() |
| 비등점 | 446°C at 760 mmHg |
| 인화점 | 226.2°C |
| 증기압 | 3.79E-08mmHg at 25°C |
| MSDS | |