Chemindex > 7152-40-1
KR ▼
7152-40-1 5-Amino-4-cyano-1-phenyl-3-pyrazoleacetonitrile |
|
| 상품명칭 | 5-Amino-4-cyano-1-phenyl-3-pyrazoleacetonitrile |
| 영문 이름 | 5-Amino-4-cyano-1-phenyl-3-pyrazoleacetonitrile;1H-pyrazole-3-acetonitrile, 5-amino-4-cyano-1-phenyl-;1H-Pyrazole-4-carbonitrile, 5-amino-3-cyanomethyl-1-phenyl-;5-Amino-3-cyanomethyl-1-phenyl-1H-pyrazole-4-carbonitrile |
| 분자식 | C12H9N5 |
| 분자량 | 223.2334 |
| InChI | InChI=1/C12H9N5/c13-7-6-11-10(8-14)12(15)17(16-11)9-4-2-1-3-5-9/h1-5H,6,15H2 |
| cas번호 | 7152-40-1 |
| EC번호 | 230-496-6 |
| 분자 구조 |  |
| 밀도 | 1.27g/cm3 |
| 녹는 점 | 165.5-166.5℃ |
| 비등점 | 486.8°C at 760 mmHg |
| 굴절 지수 | 1.673 |
| 인화점 | 248.2°C |
| 증기압 | 1.26E-09mmHg at 25°C |
| 위험성 표시 |  Xn##Harmful:; |
| 리스크 규칙 | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
| 보안 규칙 | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |
- 중국에서 화학 물질을 공급할 계획이라면 ChemNet 쇼핑몰로 이동하면 중국 제조업체로부터 최신의 경쟁력있는 가격을 얻을 수 있습니다.방문하십시오
ChemNet Mall
Chemical CAS Database Service는 ChemIndex.com 에서 제공합니다. 